C11H13FN+ — CID 171629318
fluoro-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-propan-2-ylideneazanium (PubChem CID 171629318) has the molecular formula C11H13FN+ and a molecular weight of 178.23 g/mol. Its IUPAC name is fluoro-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-propan-2-ylideneazanium.
| Compound Name | fluoro-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-propan-2-ylideneazanium |
|---|---|
| PubChem CID | 171629318 |
| Molecular Formula | C11H13FN+ |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | fluoro-[(Z)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]-propan-2-ylideneazanium |
| SMILES | C=c1cccc/c1=C/[N+](F)=C(C)C |
| InChI | InChI=1S/C11H13FN/c1-9(2)13(12)8-11-7-5-4-6-10(11)3/h4-8H,3H2,1-2H3/q+1/b11-8- |
| InChIKey | KAZWXVVJYCOTOH-FLIBITNWSA-N |
| XLogP | 1.21 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|