C24H16BrF4N5O — CID 171630049
13-bromo-5-(difluoromethyl)-8-(2,6-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene (PubChem CID 171630049) has the molecular formula C24H16BrF4N5O and a molecular weight of 546.32 g/mol. Its IUPAC name is 13-bromo-5-(difluoromethyl)-8-(2,6-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene.
| Compound Name | 13-bromo-5-(difluoromethyl)-8-(2,6-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene |
|---|---|
| PubChem CID | 171630049 |
| Molecular Formula | C24H16BrF4N5O |
| Molecular Weight | 546.32 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 13-bromo-5-(difluoromethyl)-8-(2,6-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene |
| SMILES | COc1ccc(Cn2nc(C(F)F)c3c2-c2cc(Br)ncc2NC(c2c(F)cccc2F)=N3)cc1 |
| InChI | InChI=1S/C24H16BrF4N5O/c1-35-13-7-5-12(6-8-13)11-34-22-14-9-18(25)30-10-17(14)31-24(19-15(26)3-2-4-16(19)27)32-20(22)21(33-34)23(28)29/h2-10,23H,11H2,1H3,(H,31,32) |
| InChIKey | PVFBGJKYSKVELM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.32 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|