C29H37F2N5O2Si — CID 171630051
2-[[5-(2,6-difluorophenyl)-9-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630051) has the molecular formula C29H37F2N5O2Si and a molecular weight of 553.73 g/mol. Its IUPAC name is 2-[[5-(2,6-difluorophenyl)-9-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(2,6-difluorophenyl)-9-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630051 |
| Molecular Formula | C29H37F2N5O2Si |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 2-[[5-(2,6-difluorophenyl)-9-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)Nc1ccc(N3C[C@H](C)O[C@@H](C)C3)cc1-2 |
| InChI | InChI=1S/C29H37F2N5O2Si/c1-18-15-35(16-19(2)38-18)21-10-11-25-22(14-21)28-27(20(3)34-36(28)17-37-12-13-39(4,5)6)33-29(32-25)26-23(30)8-7-9-24(26)31/h7-11,14,18-19H,12-13,15-17H2,1-6H3,(H,32,33)/t18-,19-/m0/s1 |
| InChIKey | GGXPOWXYPCYGCW-OALUTQOASA-N |
| XLogP | 6.57 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|