C19H18N5O2+ — CID 171630725
2-methyl-4-(4-phenyl-3,5-dihydro-2H-pyrazin-1-ium-1-carbonyl)pyrido[3,4-d]pyridazin-1-one (PubChem CID 171630725) has the molecular formula C19H18N5O2+ and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-methyl-4-(4-phenyl-3,5-dihydro-2H-pyrazin-1-ium-1-carbonyl)pyrido[3,4-d]pyridazin-1-one.
| Compound Name | 2-methyl-4-(4-phenyl-3,5-dihydro-2H-pyrazin-1-ium-1-carbonyl)pyrido[3,4-d]pyridazin-1-one |
|---|---|
| PubChem CID | 171630725 |
| Molecular Formula | C19H18N5O2+ |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-methyl-4-(4-phenyl-3,5-dihydro-2H-pyrazin-1-ium-1-carbonyl)pyrido[3,4-d]pyridazin-1-one |
| SMILES | Cn1nc(C(=O)[N+]2=CCN(c3ccccc3)CC2)c2cnccc2c1=O |
| InChI | InChI=1S/C19H18N5O2/c1-22-18(25)15-7-8-20-13-16(15)17(21-22)19(26)24-11-9-23(10-12-24)14-5-3-2-4-6-14/h2-8,11,13H,9-10,12H2,1H3/q+1 |
| InChIKey | CBMQEONOJMHFOH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 71.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|