About 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid
2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid (PubChem CID 171631011) has the molecular formula C9H7N3O3
and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid.
Analyze 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid?
The IUPAC name of 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid (CID 171631011) is 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid.
What is the SMILES notation for 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid?
The canonical SMILES for 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid is Cn1nc(C(=O)O)c2cnccc2c1=O.
What is the InChIKey of 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid?
The InChIKey is JOZWEMUGZVTEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3/c1-12-8(13)5-2-3-10-4-6(5)7(11-12)9(14)15/h2-4H,1H3,(H,14,15).
What are the key properties of 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid?
2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid has a molecular weight of 205.17 g/mol, XLogP of 0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-oxopyrido[3,4-d]pyridazine-4-carboxylic acid is sourced from PubChem (CID 171631011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).