About 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one
4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one (PubChem CID 171631017) has the molecular formula C9H8ClN3O
and a molecular weight of 209.64 g/mol. Its IUPAC name is 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one.
Molecular Properties
| Compound Name | 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one |
| PubChem CID | 171631017 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one |
| SMILES | CCn1nc(Cl)c2cnccc2c1=O |
| InChI | InChI=1S/C9H8ClN3O/c1-2-13-9(14)6-3-4-11-5-7(6)8(10)12-13/h3-5H,2H2,1H3 |
| InChIKey | DOQOXJZDVOZJBI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one?
The IUPAC name of 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one (CID 171631017) is 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one.
What is the SMILES notation for 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one?
The canonical SMILES for 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one is CCn1nc(Cl)c2cnccc2c1=O.
What is the InChIKey of 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one?
The InChIKey is DOQOXJZDVOZJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN3O/c1-2-13-9(14)6-3-4-11-5-7(6)8(10)12-13/h3-5H,2H2,1H3.
What are the key properties of 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one?
4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one has a molecular weight of 209.64 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one is sourced from PubChem (CID 171631017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).