C9H8ClN3O — CID 171631017
4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one (PubChem CID 171631017) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one.
| Compound Name | 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one |
|---|---|
| PubChem CID | 171631017 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 4-chloro-2-ethylpyrido[3,4-d]pyridazin-1-one |
| SMILES | CCn1nc(Cl)c2cnccc2c1=O |
| InChI | InChI=1S/C9H8ClN3O/c1-2-13-9(14)6-3-4-11-5-7(6)8(10)12-13/h3-5H,2H2,1H3 |
| InChIKey | DOQOXJZDVOZJBI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |