C38H72N2O6S — CID 171634332
heptadecan-9-yl 2-[(3-hexoxy-3-oxopropyl)sulfanylmethyl]-4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate (PubChem CID 171634332) has the molecular formula C38H72N2O6S and a molecular weight of 685.07 g/mol. Its IUPAC name is heptadecan-9-yl 2-[(3-hexoxy-3-oxopropyl)sulfanylmethyl]-4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate.
| Compound Name | heptadecan-9-yl 2-[(3-hexoxy-3-oxopropyl)sulfanylmethyl]-4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 171634332 |
| Molecular Formula | C38H72N2O6S |
| Molecular Weight | 685.07 g/mol |
| Exact Mass | 684.51 |
| IUPAC Name | heptadecan-9-yl 2-[(3-hexoxy-3-oxopropyl)sulfanylmethyl]-4-(3-morpholin-4-ylpropylamino)-4-oxobutanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)C(CSCCC(=O)OCCCCCC)CC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C38H72N2O6S/c1-4-7-10-13-15-17-21-35(22-18-16-14-11-8-5-2)46-38(43)34(33-47-31-23-37(42)45-28-19-12-9-6-3)32-36(41)39-24-20-25-40-26-29-44-30-27-40/h34-35H,4-33H2,1-3H3,(H,39,41) |
| InChIKey | ZVQLEOMGDKWFKV-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.07 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|