C21H17ClF2N2O — CID 171634904
3-[(2-chloro-4-pyridinyl)methyl]-N-[(3,5-difluorophenyl)methyl]-2-methylbenzamide (PubChem CID 171634904) has the molecular formula C21H17ClF2N2O and a molecular weight of 386.83 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)methyl]-N-[(3,5-difluorophenyl)methyl]-2-methylbenzamide.
| Compound Name | 3-[(2-chloro-4-pyridinyl)methyl]-N-[(3,5-difluorophenyl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 171634904 |
| Molecular Formula | C21H17ClF2N2O |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)methyl]-N-[(3,5-difluorophenyl)methyl]-2-methylbenzamide |
| SMILES | Cc1c(Cc2ccnc(Cl)c2)cccc1C(=O)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H17ClF2N2O/c1-13-16(7-14-5-6-25-20(22)10-14)3-2-4-19(13)21(27)26-12-15-8-17(23)11-18(24)9-15/h2-6,8-11H,7,12H2,1H3,(H,26,27) |
| InChIKey | MHXKEDQLJUTPRB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|