C25H18F3N3O2 — CID 171634914
N-[(3,5-difluorophenyl)methyl]-3-[[2-(6-fluoro-3-pyridinyl)-4-pyridinyl]oxy]-2-methylbenzamide (PubChem CID 171634914) has the molecular formula C25H18F3N3O2 and a molecular weight of 449.43 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-3-[[2-(6-fluoro-3-pyridinyl)-4-pyridinyl]oxy]-2-methylbenzamide.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-3-[[2-(6-fluoro-3-pyridinyl)-4-pyridinyl]oxy]-2-methylbenzamide |
|---|---|
| PubChem CID | 171634914 |
| Molecular Formula | C25H18F3N3O2 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-3-[[2-(6-fluoro-3-pyridinyl)-4-pyridinyl]oxy]-2-methylbenzamide |
| SMILES | Cc1c(Oc2ccnc(-c3ccc(F)nc3)c2)cccc1C(=O)NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H18F3N3O2/c1-15-21(25(32)31-13-16-9-18(26)11-19(27)10-16)3-2-4-23(15)33-20-7-8-29-22(12-20)17-5-6-24(28)30-14-17/h2-12,14H,13H2,1H3,(H,31,32) |
| InChIKey | BIKAGDVEUBDJSB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|