C29H31F2N3O3 — CID 171635153
N-[(3,5-difluorophenyl)methyl]-3-[[2-[[(Z,2E)-2-ethylidenepent-3-enoyl]amino]-4-pyridinyl]oxy]-2-methylbenzamide;ethane (PubChem CID 171635153) has the molecular formula C29H31F2N3O3 and a molecular weight of 507.58 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-3-[[2-[[(Z,2E)-2-ethylidenepent-3-enoyl]amino]-4-pyridinyl]oxy]-2-methylbenzamide;ethane.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-3-[[2-[[(Z,2E)-2-ethylidenepent-3-enoyl]amino]-4-pyridinyl]oxy]-2-methylbenzamide;ethane |
|---|---|
| PubChem CID | 171635153 |
| Molecular Formula | C29H31F2N3O3 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-3-[[2-[[(Z,2E)-2-ethylidenepent-3-enoyl]amino]-4-pyridinyl]oxy]-2-methylbenzamide;ethane |
| SMILES | C/C=C\C(=C/C)C(=O)Nc1cc(Oc2cccc(C(=O)NCc3cc(F)cc(F)c3)c2C)ccn1.CC |
| InChI | InChI=1S/C27H25F2N3O3.C2H6/c1-4-7-19(5-2)26(33)32-25-15-22(10-11-30-25)35-24-9-6-8-23(17(24)3)27(34)31-16-18-12-20(28)14-21(29)13-18;1-2/h4-15H,16H2,1-3H3,(H,31,34)(H,30,32,33);1-2H3/b7-4-,19-5+; |
| InChIKey | HQDMJAJMSWNSMO-MZJQGMAHSA-N |
| XLogP | 6.88 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|