C25H24FN3O2 — CID 171635273
N-[(4-fluorophenyl)methyl]-2-methyl-3-[[2-[(E)-1-methyliminobut-2-en-2-yl]-4-pyridinyl]oxy]benzamide (PubChem CID 171635273) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-methyl-3-[[2-[(E)-1-methyliminobut-2-en-2-yl]-4-pyridinyl]oxy]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-methyl-3-[[2-[(E)-1-methyliminobut-2-en-2-yl]-4-pyridinyl]oxy]benzamide |
|---|---|
| PubChem CID | 171635273 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-methyl-3-[[2-[(E)-1-methyliminobut-2-en-2-yl]-4-pyridinyl]oxy]benzamide |
| SMILES | C/C=C(\C=N\C)c1cc(Oc2cccc(C(=O)NCc3ccc(F)cc3)c2C)ccn1 |
| InChI | InChI=1S/C25H24FN3O2/c1-4-19(16-27-3)23-14-21(12-13-28-23)31-24-7-5-6-22(17(24)2)25(30)29-15-18-8-10-20(26)11-9-18/h4-14,16H,15H2,1-3H3,(H,29,30)/b19-4+,27-16+ |
| InChIKey | AMKZQSATGZXMFD-OIANBRLHSA-N |
| XLogP | 5.36 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|