C27H31ClN4O2 — CID 171635439
N-[(3-chlorophenyl)methyl]-2-methyl-3-[[2-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]-4-pyridinyl]oxy]benzamide;ethane (PubChem CID 171635439) has the molecular formula C27H31ClN4O2 and a molecular weight of 479.02 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-methyl-3-[[2-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]-4-pyridinyl]oxy]benzamide;ethane.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-methyl-3-[[2-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]-4-pyridinyl]oxy]benzamide;ethane |
|---|---|
| PubChem CID | 171635439 |
| Molecular Formula | C27H31ClN4O2 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-methyl-3-[[2-[[N-methyl-C-[(Z)-prop-1-enyl]carbonimidoyl]amino]-4-pyridinyl]oxy]benzamide;ethane |
| SMILES | C/C=C\C(=N/C)Nc1cc(Oc2cccc(C(=O)NCc3cccc(Cl)c3)c2C)ccn1.CC |
| InChI | InChI=1S/C25H25ClN4O2.C2H6/c1-4-7-23(27-3)30-24-15-20(12-13-28-24)32-22-11-6-10-21(17(22)2)25(31)29-16-18-8-5-9-19(26)14-18;1-2/h4-15H,16H2,1-3H3,(H,29,31)(H,27,28,30);1-2H3/b7-4-; |
| InChIKey | HKMCFBMRALBLGT-ZULQGGHCSA-N |
| XLogP | 6.81 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|