C30H34FN3O2 — CID 171635508
ethane;(E)-2-ethenyl-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]pent-2-enamide (PubChem CID 171635508) has the molecular formula C30H34FN3O2 and a molecular weight of 487.62 g/mol. Its IUPAC name is ethane;(E)-2-ethenyl-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]pent-2-enamide.
| Compound Name | ethane;(E)-2-ethenyl-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]pent-2-enamide |
|---|---|
| PubChem CID | 171635508 |
| Molecular Formula | C30H34FN3O2 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | ethane;(E)-2-ethenyl-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]pent-2-enamide |
| SMILES | C=C/C(=C\CC)C(=O)Nc1cc(Oc2cccc(C(=C)NCc3cccc(F)c3)c2C)ccn1.CC |
| InChI | InChI=1S/C28H28FN3O2.C2H6/c1-5-9-22(6-2)28(33)32-27-17-24(14-15-30-27)34-26-13-8-12-25(19(26)3)20(4)31-18-21-10-7-11-23(29)16-21;1-2/h6-17,31H,2,4-5,18H2,1,3H3,(H,30,32,33);1-2H3/b22-9+; |
| InChIKey | KTIOXGSJUOBXAJ-PXSFLOMMSA-N |
| XLogP | 7.57 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|