C29H31FN4O2 — CID 171635539
(2E)-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]-2-(2-methyliminoethylidene)pentanamide (PubChem CID 171635539) has the molecular formula C29H31FN4O2 and a molecular weight of 486.59 g/mol. Its IUPAC name is (2E)-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]-2-(2-methyliminoethylidene)pentanamide.
| Compound Name | (2E)-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]-2-(2-methyliminoethylidene)pentanamide |
|---|---|
| PubChem CID | 171635539 |
| Molecular Formula | C29H31FN4O2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | (2E)-N-[4-[3-[1-[(3-fluorophenyl)methylamino]ethenyl]-2-methylphenoxy]-2-pyridinyl]-2-(2-methyliminoethylidene)pentanamide |
| SMILES | C=C(NCc1cccc(F)c1)c1cccc(Oc2ccnc(NC(=O)/C(=C/C=N/C)CCC)c2)c1C |
| InChI | InChI=1S/C29H31FN4O2/c1-5-8-23(13-15-31-4)29(35)34-28-18-25(14-16-32-28)36-27-12-7-11-26(20(27)2)21(3)33-19-22-9-6-10-24(30)17-22/h6-7,9-18,33H,3,5,8,19H2,1-2,4H3,(H,32,34,35)/b23-13+,31-15+ |
| InChIKey | MUCLNSIOAVTEJP-KEDHFUJJSA-N |
| XLogP | 6.45 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|