C22H21N5O2S — CID 171637683
N-[2-[(4-pyridin-3-ylphenyl)methylamino]ethyl]quinazoline-6-sulfonamide (PubChem CID 171637683) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[2-[(4-pyridin-3-ylphenyl)methylamino]ethyl]quinazoline-6-sulfonamide.
| Compound Name | N-[2-[(4-pyridin-3-ylphenyl)methylamino]ethyl]quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 171637683 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[2-[(4-pyridin-3-ylphenyl)methylamino]ethyl]quinazoline-6-sulfonamide |
| SMILES | O=S(=O)(NCCNCc1ccc(-c2cccnc2)cc1)c1ccc2ncncc2c1 |
| InChI | InChI=1S/C22H21N5O2S/c28-30(29,21-7-8-22-20(12-21)15-25-16-26-22)27-11-10-24-13-17-3-5-18(6-4-17)19-2-1-9-23-14-19/h1-9,12,14-16,24,27H,10-11,13H2 |
| InChIKey | GWWHDDXPVNMSBN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|