C22H24N4O2S — CID 155556081
2-amino-N-[2-[[(E)-3-(4-pyridin-3-ylphenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide (PubChem CID 155556081) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 2-amino-N-[2-[[(E)-3-(4-pyridin-3-ylphenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 2-amino-N-[2-[[(E)-3-(4-pyridin-3-ylphenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155556081 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-amino-N-[2-[[(E)-3-(4-pyridin-3-ylphenyl)prop-2-enyl]amino]ethyl]benzenesulfonamide |
| SMILES | Nc1ccccc1S(=O)(=O)NCCNC/C=C/c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C22H24N4O2S/c23-21-7-1-2-8-22(21)29(27,28)26-16-15-24-13-3-5-18-9-11-19(12-10-18)20-6-4-14-25-17-20/h1-12,14,17,24,26H,13,15-16,23H2/b5-3+ |
| InChIKey | KGHYYLODOFRPEK-HWKANZROSA-N |
| XLogP | 2.91 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|