C23H22F3N3O2S — CID 54008955
N-[2-[5-[4-(trifluoromethyl)phenyl]penta-2,4-dienylamino]ethyl]isoquinoline-5-sulfonamide (PubChem CID 54008955) has the molecular formula C23H22F3N3O2S and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[2-[5-[4-(trifluoromethyl)phenyl]penta-2,4-dienylamino]ethyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[2-[5-[4-(trifluoromethyl)phenyl]penta-2,4-dienylamino]ethyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 54008955 |
| Molecular Formula | C23H22F3N3O2S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[2-[5-[4-(trifluoromethyl)phenyl]penta-2,4-dienylamino]ethyl]isoquinoline-5-sulfonamide |
| SMILES | O=S(=O)(NCCNCC=CC=Cc1ccc(C(F)(F)F)cc1)c1cccc2cnccc12 |
| InChI | InChI=1S/C23H22F3N3O2S/c24-23(25,26)20-10-8-18(9-11-20)5-2-1-3-13-27-15-16-29-32(30,31)22-7-4-6-19-17-28-14-12-21(19)22/h1-12,14,17,27,29H,13,15-16H2 |
| InChIKey | KQXWLQZEJLOEMO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|