C36H52F4N6O4 — CID 171638481
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 171638481) has the molecular formula C36H52F4N6O4 and a molecular weight of 708.84 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 171638481 |
| Molecular Formula | C36H52F4N6O4 |
| Molecular Weight | 708.84 g/mol |
| Exact Mass | 708.40 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]formamide;ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-(2-methoxy-4-methylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CC.COc1cc(C)ccc1NCC#Cc1cc2c(NC3CCN(C)CC3F)cccc2n1CC(F)(F)F.NCCOCCOCCNC=O |
| InChI | InChI=1S/C27H30F4N4O.C7H16N2O3.C2H6/c1-18-9-10-24(26(14-18)36-3)32-12-5-6-19-15-20-22(33-23-11-13-34(2)16-21(23)28)7-4-8-25(20)35(19)17-27(29,30)31;8-1-3-11-5-6-12-4-2-9-7-10;1-2/h4,7-10,14-15,21,23,32-33H,11-13,16-17H2,1-3H3;7H,1-6,8H2,(H,9,10);1-2H3 |
| InChIKey | FITCHNVMIZRBEG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.84 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|