C27H35IN8O2 — CID 171639302
4-[[(4R)-5-(cyclohexylmethyl)-4-ethyl-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]amino]-N-(1-iodoethyl)-3-methoxybenzamide (PubChem CID 171639302) has the molecular formula C27H35IN8O2 and a molecular weight of 630.54 g/mol. Its IUPAC name is 4-[[(4R)-5-(cyclohexylmethyl)-4-ethyl-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]amino]-N-(1-iodoethyl)-3-methoxybenzamide.
| Compound Name | 4-[[(4R)-5-(cyclohexylmethyl)-4-ethyl-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]amino]-N-(1-iodoethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 171639302 |
| Molecular Formula | C27H35IN8O2 |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 4-[[(4R)-5-(cyclohexylmethyl)-4-ethyl-1-methyl-4H-[1,2,4]triazolo[4,3-f]pteridin-7-yl]amino]-N-(1-iodoethyl)-3-methoxybenzamide |
| SMILES | CC[C@@H]1c2nnc(C)n2-c2cnc(Nc3ccc(C(=O)NC(C)I)cc3OC)nc2N1CC1CCCCC1 |
| InChI | InChI=1S/C27H35IN8O2/c1-5-21-25-34-33-17(3)36(25)22-14-29-27(32-24(22)35(21)15-18-9-7-6-8-10-18)31-20-12-11-19(13-23(20)38-4)26(37)30-16(2)28/h11-14,16,18,21H,5-10,15H2,1-4H3,(H,30,37)(H,29,31,32)/t16?,21-/m1/s1 |
| InChIKey | HKILSCRBBHWXGV-CAWMZFRYSA-N |
| XLogP | 5.48 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|