C31H58N10O8 — CID 171640133
2-[7-(carboxymethyl)-4-[2-[[3-[[5-(diaminomethylideneamino)-1-(hexylamino)-1-oxopentan-2-yl]amino]-3-oxopropyl]amino]-2-oxoethyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 171640133) has the molecular formula C31H58N10O8 and a molecular weight of 698.87 g/mol. Its IUPAC name is 2-[7-(carboxymethyl)-4-[2-[[3-[[5-(diaminomethylideneamino)-1-(hexylamino)-1-oxopentan-2-yl]amino]-3-oxopropyl]amino]-2-oxoethyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[7-(carboxymethyl)-4-[2-[[3-[[5-(diaminomethylideneamino)-1-(hexylamino)-1-oxopentan-2-yl]amino]-3-oxopropyl]amino]-2-oxoethyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 171640133 |
| Molecular Formula | C31H58N10O8 |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.44 |
| IUPAC Name | 2-[7-(carboxymethyl)-4-[2-[[3-[[5-(diaminomethylideneamino)-1-(hexylamino)-1-oxopentan-2-yl]amino]-3-oxopropyl]amino]-2-oxoethyl]-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCCCCCNC(=O)C(CCCN=C(N)N)NC(=O)CCNC(=O)CN1CCN(CC(=O)O)CCN(CC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C31H58N10O8/c1-2-3-4-5-9-35-30(49)25(7-6-10-36-31(32)33)37-26(43)8-11-34-27(44)22-39-16-18-40(23-28(45)46)14-12-38(20-21-42)13-15-41(19-17-39)24-29(47)48/h21,25H,2-20,22-24H2,1H3,(H,34,44)(H,35,49)(H,37,43)(H,45,46)(H,47,48)(H4,32,33,36) |
| InChIKey | BDJSBSMQPXGBFI-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 256.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|