C23H26ClF3N4O6 — CID 171640225
1,1,1-trifluoropropan-2-yl N-[4-chloro-2-[[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]carbamoyl]phenyl]carbamate (PubChem CID 171640225) has the molecular formula C23H26ClF3N4O6 and a molecular weight of 546.93 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl N-[4-chloro-2-[[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]carbamoyl]phenyl]carbamate.
| Compound Name | 1,1,1-trifluoropropan-2-yl N-[4-chloro-2-[[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 171640225 |
| Molecular Formula | C23H26ClF3N4O6 |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl N-[4-chloro-2-[[(2S)-4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]carbamoyl]phenyl]carbamate |
| SMILES | CC(OC(=O)Nc1ccc(Cl)cc1C(=O)N[C@@H](C[C@@H]1C[C@@H](C)NC1=O)C(=O)C(=O)NC1CC1)C(F)(F)F |
| InChI | InChI=1S/C23H26ClF3N4O6/c1-10-7-12(19(33)28-10)8-17(18(32)21(35)29-14-4-5-14)30-20(34)15-9-13(24)3-6-16(15)31-22(36)37-11(2)23(25,26)27/h3,6,9-12,14,17H,4-5,7-8H2,1-2H3,(H,28,33)(H,29,35)(H,30,34)(H,31,36)/t10-,11?,12+,17+/m1/s1 |
| InChIKey | QWSAKHWZPHFVBS-MOKAEFCHSA-N |
| XLogP | 2.70 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|