C25H28ClF3N4O5 — CID 174715491
5-chloro-N-[4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-2-[[1-(2,2,2-trifluoroethyl)cyclopropanecarbonyl]amino]benzamide (PubChem CID 174715491) has the molecular formula C25H28ClF3N4O5 and a molecular weight of 556.97 g/mol. Its IUPAC name is 5-chloro-N-[4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-2-[[1-(2,2,2-trifluoroethyl)cyclopropanecarbonyl]amino]benzamide.
| Compound Name | 5-chloro-N-[4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-2-[[1-(2,2,2-trifluoroethyl)cyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 174715491 |
| Molecular Formula | C25H28ClF3N4O5 |
| Molecular Weight | 556.97 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 5-chloro-N-[4-(cyclopropylamino)-1-[(3S,5R)-5-methyl-2-oxopyrrolidin-3-yl]-3,4-dioxobutan-2-yl]-2-[[1-(2,2,2-trifluoroethyl)cyclopropanecarbonyl]amino]benzamide |
| SMILES | C[C@@H]1C[C@@H](CC(NC(=O)c2cc(Cl)ccc2NC(=O)C2(CC(F)(F)F)CC2)C(=O)C(=O)NC2CC2)C(=O)N1 |
| InChI | InChI=1S/C25H28ClF3N4O5/c1-12-8-13(20(35)30-12)9-18(19(34)22(37)31-15-3-4-15)32-21(36)16-10-14(26)2-5-17(16)33-23(38)24(6-7-24)11-25(27,28)29/h2,5,10,12-13,15,18H,3-4,6-9,11H2,1H3,(H,30,35)(H,31,37)(H,32,36)(H,33,38)/t12-,13+,18?/m1/s1 |
| InChIKey | PYIPHRBZWNPTRP-ACYVDPJOSA-N |
| XLogP | 2.87 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.97 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|