C28H32FN7O2 — CID 171640667
[(4S)-6-amino-4'-(3-cyanoazetidin-1-yl)spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-2'-yl] N-[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanimidate (PubChem CID 171640667) has the molecular formula C28H32FN7O2 and a molecular weight of 517.61 g/mol. Its IUPAC name is [(4S)-6-amino-4'-(3-cyanoazetidin-1-yl)spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-2'-yl] N-[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanimidate.
| Compound Name | [(4S)-6-amino-4'-(3-cyanoazetidin-1-yl)spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-2'-yl] N-[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanimidate |
|---|---|
| PubChem CID | 171640667 |
| Molecular Formula | C28H32FN7O2 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | [(4S)-6-amino-4'-(3-cyanoazetidin-1-yl)spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-2'-yl] N-[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanimidate |
| SMILES | N#CC1CN(c2nc(OC=NC34CCCN3C[C@H](F)C4)nc3c2CO[C@@]2(CCCc4ccc(N)cc42)C3)C1 |
| InChI | InChI=1S/C28H32FN7O2/c29-20-10-28(7-2-8-36(28)15-20)32-17-37-26-33-24-11-27(6-1-3-19-4-5-21(31)9-23(19)27)38-16-22(24)25(34-26)35-13-18(12-30)14-35/h4-5,9,17-18,20H,1-3,6-8,10-11,13-16,31H2/t20-,27+,28?/m1/s1 |
| InChIKey | RKWLVJNFFOXMNP-YSRZFHLDSA-N |
| XLogP | 3.26 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|