C30H40FN5O4 — CID 171640485
1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepane-3,6-diol (PubChem CID 171640485) has the molecular formula C30H40FN5O4 and a molecular weight of 553.68 g/mol. Its IUPAC name is 1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepane-3,6-diol.
| Compound Name | 1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepane-3,6-diol |
|---|---|
| PubChem CID | 171640485 |
| Molecular Formula | C30H40FN5O4 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | 1-[6-amino-2'-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]spiro[2,3-dihydro-1H-naphthalene-4,7'-5,8-dihydropyrano[4,3-d]pyrimidine]-4'-yl]azepane-3,6-diol |
| SMILES | Nc1ccc2c(c1)C1(CCC2)Cc2nc(OCC34CCCN3CC(F)C4)nc(N3CC(O)CCC(O)C3)c2CO1 |
| InChI | InChI=1S/C30H40FN5O4/c31-20-12-29(8-2-10-36(29)14-20)18-39-28-33-26-13-30(9-1-3-19-4-5-21(32)11-25(19)30)40-17-24(26)27(34-28)35-15-22(37)6-7-23(38)16-35/h4-5,11,20,22-23,37-38H,1-3,6-10,12-18,32H2 |
| InChIKey | CDSFKOULUIQUPC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|