C33H43FN6 — CID 171640899
2-amino-4'-(azepan-1-yl)-2'-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile (PubChem CID 171640899) has the molecular formula C33H43FN6 and a molecular weight of 542.75 g/mol. Its IUPAC name is 2-amino-4'-(azepan-1-yl)-2'-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile.
| Compound Name | 2-amino-4'-(azepan-1-yl)-2'-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile |
|---|---|
| PubChem CID | 171640899 |
| Molecular Formula | C33H43FN6 |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | 2-amino-4'-(azepan-1-yl)-2'-[2-[(8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]ethyl]spiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile |
| SMILES | N#Cc1c(N)ccc2c1C1(CCC2)CCc2c(nc(CC[C@@]34CCCN3CC(F)C4)nc2N2CCCCCC2)C1 |
| InChI | InChI=1S/C33H43FN6/c34-24-19-33(13-6-18-40(33)22-24)15-11-29-37-28-20-32(12-5-7-23-8-9-27(36)26(21-35)30(23)32)14-10-25(28)31(38-29)39-16-3-1-2-4-17-39/h8-9,24H,1-7,10-20,22,36H2/t24?,32?,33-/m1/s1 |
| InChIKey | GVUKBSJRSVLZFM-UJSWCQTGSA-N |
| XLogP | 5.58 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|