C34H45FN6 — CID 176712230
2-amino-4'-(azepan-1-yl)-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile (PubChem CID 176712230) has the molecular formula C34H45FN6 and a molecular weight of 556.77 g/mol. Its IUPAC name is 2-amino-4'-(azepan-1-yl)-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile.
| Compound Name | 2-amino-4'-(azepan-1-yl)-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile |
|---|---|
| PubChem CID | 176712230 |
| Molecular Formula | C34H45FN6 |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 2-amino-4'-(azepan-1-yl)-2'-[2-(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-5-methylspiro[6,7-dihydro-5H-naphthalene-8,7'-6,8-dihydro-5H-quinazoline]-1-carbonitrile |
| SMILES | CC1CCC2(CCc3c(nc(CCC45CCCN4CC(F)C5)nc3N3CCCCCC3)C2)c2c1ccc(N)c2C#N |
| InChI | InChI=1S/C34H45FN6/c1-23-9-13-33(31-25(23)7-8-28(37)27(31)21-36)14-10-26-29(20-33)38-30(39-32(26)40-16-4-2-3-5-17-40)11-15-34-12-6-18-41(34)22-24(35)19-34/h7-8,23-24H,2-6,9-20,22,37H2,1H3 |
| InChIKey | LEGZBPHAMFQVGJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|