C22H41N3O — CID 171641851
6-ethyl-2-[(4-piperidin-4-yloxycyclohexyl)methyl]-2,6-diazaspiro[3.3]heptane;prop-1-ene (PubChem CID 171641851) has the molecular formula C22H41N3O and a molecular weight of 363.59 g/mol. Its IUPAC name is 6-ethyl-2-[(4-piperidin-4-yloxycyclohexyl)methyl]-2,6-diazaspiro[3.3]heptane;prop-1-ene.
| Compound Name | 6-ethyl-2-[(4-piperidin-4-yloxycyclohexyl)methyl]-2,6-diazaspiro[3.3]heptane;prop-1-ene |
|---|---|
| PubChem CID | 171641851 |
| Molecular Formula | C22H41N3O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.32 |
| IUPAC Name | 6-ethyl-2-[(4-piperidin-4-yloxycyclohexyl)methyl]-2,6-diazaspiro[3.3]heptane;prop-1-ene |
| SMILES | C=CC.CCN1CC2(C1)CN(CC1CCC(OC3CCNCC3)CC1)C2 |
| InChI | InChI=1S/C19H35N3O.C3H6/c1-2-21-12-19(13-21)14-22(15-19)11-16-3-5-17(6-4-16)23-18-7-9-20-10-8-18;1-3-2/h16-18,20H,2-15H2,1H3;3H,1H2,2H3 |
| InChIKey | JVRUMFYBFMMXIQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|