C10H16F4N2 — CID 164662923
4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]piperidine (PubChem CID 164662923) has the molecular formula C10H16F4N2 and a molecular weight of 240.24 g/mol. Its IUPAC name is 4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]piperidine.
| Compound Name | 4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 164662923 |
| Molecular Formula | C10H16F4N2 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]piperidine |
| SMILES | FC1(F)CN(CC2CCNCC2)CC1(F)F |
| InChI | InChI=1S/C10H16F4N2/c11-9(12)6-16(7-10(9,13)14)5-8-1-3-15-4-2-8/h8,15H,1-7H2 |
| InChIKey | MSGFBEYEYLIKSH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|