C21H28N4O2 — CID 171644381
1-[(3R)-1-acetylpiperidin-3-yl]-3-[(5-cyclopropyl-1H-indol-2-yl)methyl]-1-methylurea (PubChem CID 171644381) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(3R)-1-acetylpiperidin-3-yl]-3-[(5-cyclopropyl-1H-indol-2-yl)methyl]-1-methylurea.
| Compound Name | 1-[(3R)-1-acetylpiperidin-3-yl]-3-[(5-cyclopropyl-1H-indol-2-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 171644381 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-[(3R)-1-acetylpiperidin-3-yl]-3-[(5-cyclopropyl-1H-indol-2-yl)methyl]-1-methylurea |
| SMILES | CC(=O)N1CCC[C@@H](N(C)C(=O)NCc2cc3cc(C4CC4)ccc3[nH]2)C1 |
| InChI | InChI=1S/C21H28N4O2/c1-14(26)25-9-3-4-19(13-25)24(2)21(27)22-12-18-11-17-10-16(15-5-6-15)7-8-20(17)23-18/h7-8,10-11,15,19,23H,3-6,9,12-13H2,1-2H3,(H,22,27)/t19-/m1/s1 |
| InChIKey | PSKYKDCVOQEDKL-LJQANCHMSA-N |
| XLogP | 3.20 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |