C26H29ClN4O3S — CID 171645712
N-(1-tert-butylpyrazol-4-yl)formamide;4-(2-chloro-4-ethylphenoxy)-6-methylsulfinylquinoline (PubChem CID 171645712) has the molecular formula C26H29ClN4O3S and a molecular weight of 513.06 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-4-yl)formamide;4-(2-chloro-4-ethylphenoxy)-6-methylsulfinylquinoline.
| Compound Name | N-(1-tert-butylpyrazol-4-yl)formamide;4-(2-chloro-4-ethylphenoxy)-6-methylsulfinylquinoline |
|---|---|
| PubChem CID | 171645712 |
| Molecular Formula | C26H29ClN4O3S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N-(1-tert-butylpyrazol-4-yl)formamide;4-(2-chloro-4-ethylphenoxy)-6-methylsulfinylquinoline |
| SMILES | CC(C)(C)n1cc(NC=O)cn1.CCc1ccc(Oc2ccnc3ccc(S(C)=O)cc23)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClNO2S.C8H13N3O/c1-3-12-4-7-18(15(19)10-12)22-17-8-9-20-16-6-5-13(23(2)21)11-14(16)17;1-8(2,3)11-5-7(4-10-11)9-6-12/h4-11H,3H2,1-2H3;4-6H,1-3H3,(H,9,12) |
| InChIKey | XLRHZXQTEBDSGY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|