C28H31FN4O4S — CID 171645788
N-(1-tert-butylpyrazol-4-yl)formamide;4-(4-ethyl-3-fluorophenoxy)-6-(oxetan-3-ylsulfinyl)quinoline (PubChem CID 171645788) has the molecular formula C28H31FN4O4S and a molecular weight of 538.65 g/mol. Its IUPAC name is N-(1-tert-butylpyrazol-4-yl)formamide;4-(4-ethyl-3-fluorophenoxy)-6-(oxetan-3-ylsulfinyl)quinoline.
| Compound Name | N-(1-tert-butylpyrazol-4-yl)formamide;4-(4-ethyl-3-fluorophenoxy)-6-(oxetan-3-ylsulfinyl)quinoline |
|---|---|
| PubChem CID | 171645788 |
| Molecular Formula | C28H31FN4O4S |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | N-(1-tert-butylpyrazol-4-yl)formamide;4-(4-ethyl-3-fluorophenoxy)-6-(oxetan-3-ylsulfinyl)quinoline |
| SMILES | CC(C)(C)n1cc(NC=O)cn1.CCc1ccc(Oc2ccnc3ccc(S(=O)C4COC4)cc23)cc1F |
| InChI | InChI=1S/C20H18FNO3S.C8H13N3O/c1-2-13-3-4-14(9-18(13)21)25-20-7-8-22-19-6-5-15(10-17(19)20)26(23)16-11-24-12-16;1-8(2,3)11-5-7(4-10-11)9-6-12/h3-10,16H,2,11-12H2,1H3;4-6H,1-3H3,(H,9,12) |
| InChIKey | RGPIBKYIOVSSAH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|