C17H23N3O3 — CID 171646905
N-[(1R)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-6-carboxamide (PubChem CID 171646905) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[(1R)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-6-carboxamide.
| Compound Name | N-[(1R)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 171646905 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[(1R)-1-(4-methoxyphenyl)ethyl]-2-oxo-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidine-6-carboxamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)C2CC3CNC(=O)NC3C2)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-10(11-3-5-14(23-2)6-4-11)19-16(21)12-7-13-9-18-17(22)20-15(13)8-12/h3-6,10,12-13,15H,7-9H2,1-2H3,(H,19,21)(H2,18,20,22)/t10-,12?,13?,15?/m1/s1 |
| InChIKey | WRGYRQOQXDHCLL-ZBFOYUMQSA-N |
| XLogP | 1.58 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |