C21H27N3O3 — CID 169417638
N-[4-[[(1R)-1-(4-methoxyphenyl)ethyl]carbamoyl]cyclohexyl]-1H-pyrrole-2-carboxamide (PubChem CID 169417638) has the molecular formula C21H27N3O3 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[4-[[(1R)-1-(4-methoxyphenyl)ethyl]carbamoyl]cyclohexyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[4-[[(1R)-1-(4-methoxyphenyl)ethyl]carbamoyl]cyclohexyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 169417638 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[4-[[(1R)-1-(4-methoxyphenyl)ethyl]carbamoyl]cyclohexyl]-1H-pyrrole-2-carboxamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)C2CCC(NC(=O)c3ccc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-14(15-7-11-18(27-2)12-8-15)23-20(25)16-5-9-17(10-6-16)24-21(26)19-4-3-13-22-19/h3-4,7-8,11-14,16-17,22H,5-6,9-10H2,1-2H3,(H,23,25)(H,24,26)/t14-,16?,17?/m1/s1 |
| InChIKey | OJLJELUORLRQCX-ODIFPOPNSA-N |
| XLogP | 3.19 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |