C27H24F2N2O2 — CID 171648502
[5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-dihydroisoquinolin-2-yl]methanone (PubChem CID 171648502) has the molecular formula C27H24F2N2O2 and a molecular weight of 446.50 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-dihydroisoquinolin-2-yl]methanone.
| Compound Name | [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-dihydroisoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 171648502 |
| Molecular Formula | C27H24F2N2O2 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [5-(2,4-difluorophenyl)-1,2-oxazol-3-yl]-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methyl-1,3-dihydroisoquinolin-2-yl]methanone |
| SMILES | C=C/C(=C\C=C/C)C1(C)CN(C(=O)c2cc(-c3ccc(F)cc3F)on2)Cc2ccccc21 |
| InChI | InChI=1S/C27H24F2N2O2/c1-4-6-10-19(5-2)27(3)17-31(16-18-9-7-8-11-22(18)27)26(32)24-15-25(33-30-24)21-13-12-20(28)14-23(21)29/h4-15H,2,16-17H2,1,3H3/b6-4-,19-10+ |
| InChIKey | FROSCRPURDVVNS-NSFRZYPPSA-N |
| XLogP | 6.22 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|