C9H16FN3O — CID 171649243
4-(3-fluoropropoxymethyl)-1-propan-2-yltriazole (PubChem CID 171649243) has the molecular formula C9H16FN3O and a molecular weight of 201.24 g/mol. Its IUPAC name is 4-(3-fluoropropoxymethyl)-1-propan-2-yltriazole.
| Compound Name | 4-(3-fluoropropoxymethyl)-1-propan-2-yltriazole |
|---|---|
| PubChem CID | 171649243 |
| Molecular Formula | C9H16FN3O |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4-(3-fluoropropoxymethyl)-1-propan-2-yltriazole |
| SMILES | CC(C)n1cc(COCCCF)nn1 |
| InChI | InChI=1S/C9H16FN3O/c1-8(2)13-6-9(11-12-13)7-14-5-3-4-10/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | XSVLXTNQUNALFX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|