C8H16N2S — CID 171649361
(2S)-N,N,1-trimethylpyrrolidine-2-carbothioamide (PubChem CID 171649361) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is (2S)-N,N,1-trimethylpyrrolidine-2-carbothioamide.
| Compound Name | (2S)-N,N,1-trimethylpyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 171649361 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (2S)-N,N,1-trimethylpyrrolidine-2-carbothioamide |
| SMILES | CN(C)C(=S)[C@@H]1CCCN1C |
| InChI | InChI=1S/C8H16N2S/c1-9(2)8(11)7-5-4-6-10(7)3/h7H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | HBUIRLPPXXBACK-ZETCQYMHSA-N |
| XLogP | 0.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|