C19H29N3O5S2 — CID 171649445
tert-butyl (2S,4R)-2-(dimethylcarbamothioyl)-4-[(3-sulfamoylphenyl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 171649445) has the molecular formula C19H29N3O5S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(dimethylcarbamothioyl)-4-[(3-sulfamoylphenyl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(dimethylcarbamothioyl)-4-[(3-sulfamoylphenyl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171649445 |
| Molecular Formula | C19H29N3O5S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | tert-butyl (2S,4R)-2-(dimethylcarbamothioyl)-4-[(3-sulfamoylphenyl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=S)[C@@H]1C[C@@H](OCc2cccc(S(N)(=O)=O)c2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O5S2/c1-19(2,3)27-18(23)22-11-14(10-16(22)17(28)21(4)5)26-12-13-7-6-8-15(9-13)29(20,24)25/h6-9,14,16H,10-12H2,1-5H3,(H2,20,24,25)/t14-,16+/m1/s1 |
| InChIKey | UZUNPHGNAFJAOB-ZBFHGGJFSA-N |
| XLogP | 2.12 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|