C8H6F6N2O — CID 171656686
6-methyl-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 171656686) has the molecular formula C8H6F6N2O and a molecular weight of 260.14 g/mol. Its IUPAC name is 6-methyl-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-methyl-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171656686 |
| Molecular Formula | C8H6F6N2O |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 6-methyl-4-(trifluoromethoxy)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1nc(N)cc(OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2O/c1-3-6(7(9,10)11)4(2-5(15)16-3)17-8(12,13)14/h2H,1H3,(H2,15,16) |
| InChIKey | MYTSRXSDDGBINM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |