C23H22BF3N4O — CID 171658362
CID 171658362 (PubChem CID 171658362) has the molecular formula C23H22BF3N4O and a molecular weight of 438.26 g/mol.
| Compound Name | CID 171658362 |
|---|---|
| PubChem CID | 171658362 |
| Molecular Formula | C23H22BF3N4O |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc(NCc2cccc(C(F)F)c2F)c2cc(C3CCN(C(=O)NC)C3)ccc2n1 |
| InChI | InChI=1S/C23H22BF3N4O/c1-28-23(32)31-8-7-15(12-31)13-5-6-18-17(9-13)19(10-20(24)30-18)29-11-14-3-2-4-16(21(14)25)22(26)27/h2-6,9-10,15,22H,7-8,11-12H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | PJKHTTPMUBJWHU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|