C25H28BF3N4O2 — CID 171658486
CID 171658486 (PubChem CID 171658486) has the molecular formula C25H28BF3N4O2 and a molecular weight of 484.33 g/mol.
| Compound Name | CID 171658486 |
|---|---|
| PubChem CID | 171658486 |
| Molecular Formula | C25H28BF3N4O2 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | — |
| SMILES | COC1CCN(C(=O)N(C)C)C1.[B]c1cc(NCc2cccc(C(F)F)c2F)c2ccccc2n1 |
| InChI | InChI=1S/C17H12BF3N2.C8H16N2O2/c18-15-8-14(11-5-1-2-7-13(11)23-15)22-9-10-4-3-6-12(16(10)19)17(20)21;1-9(2)8(11)10-5-4-7(6-10)12-3/h1-8,17H,9H2,(H,22,23);7H,4-6H2,1-3H3 |
| InChIKey | LDWWPEOUDKFYPX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|