C27H29BF3N3O2 — CID 174336933
CID 174336933 (PubChem CID 174336933) has the molecular formula C27H29BF3N3O2 and a molecular weight of 495.35 g/mol.
| Compound Name | CID 174336933 |
|---|---|
| PubChem CID | 174336933 |
| Molecular Formula | C27H29BF3N3O2 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | — |
| SMILES | [B]c1cc(N[C@H](C)c2cccc(C(F)F)c2F)c2cc([C@]3(OC)CCN(C(=O)C(C)C)C3)ccc2n1 |
| InChI | InChI=1S/C27H29BF3N3O2/c1-15(2)26(35)34-11-10-27(14-34,36-4)17-8-9-21-20(12-17)22(13-23(28)33-21)32-16(3)18-6-5-7-19(24(18)29)25(30)31/h5-9,12-13,15-16,25H,10-11,14H2,1-4H3,(H,32,33)/t16-,27+/m1/s1 |
| InChIKey | KQYOGYSOKBEXKQ-JWIGPWBQSA-N |
| XLogP | 5.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|