C25H29F3N4O3 — CID 175500287
N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-7-methoxy-2-methyl-6-piperazin-1-ylquinolin-4-amine;formic acid (PubChem CID 175500287) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-7-methoxy-2-methyl-6-piperazin-1-ylquinolin-4-amine;formic acid.
| Compound Name | N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-7-methoxy-2-methyl-6-piperazin-1-ylquinolin-4-amine;formic acid |
|---|---|
| PubChem CID | 175500287 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]-7-methoxy-2-methyl-6-piperazin-1-ylquinolin-4-amine;formic acid |
| SMILES | COc1cc2nc(C)cc(NC(C)c3cccc(C(F)F)c3F)c2cc1N1CCNCC1.O=CO |
| InChI | InChI=1S/C24H27F3N4O.CH2O2/c1-14-11-19(30-15(2)16-5-4-6-17(23(16)25)24(26)27)18-12-21(31-9-7-28-8-10-31)22(32-3)13-20(18)29-14;2-1-3/h4-6,11-13,15,24,28H,7-10H2,1-3H3,(H,29,30);1H,(H,2,3) |
| InChIKey | DNUIUFOYRNIZSC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|