C23H28FN5 — CID 170555816
N-[(1R)-1-(5-amino-2-fluoro-3-methylphenyl)ethyl]-2-methyl-6-piperazin-1-ylquinolin-4-amine (PubChem CID 170555816) has the molecular formula C23H28FN5 and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(1R)-1-(5-amino-2-fluoro-3-methylphenyl)ethyl]-2-methyl-6-piperazin-1-ylquinolin-4-amine.
| Compound Name | N-[(1R)-1-(5-amino-2-fluoro-3-methylphenyl)ethyl]-2-methyl-6-piperazin-1-ylquinolin-4-amine |
|---|---|
| PubChem CID | 170555816 |
| Molecular Formula | C23H28FN5 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[(1R)-1-(5-amino-2-fluoro-3-methylphenyl)ethyl]-2-methyl-6-piperazin-1-ylquinolin-4-amine |
| SMILES | Cc1cc(N[C@H](C)c2cc(N)cc(C)c2F)c2cc(N3CCNCC3)ccc2n1 |
| InChI | InChI=1S/C23H28FN5/c1-14-10-17(25)12-19(23(14)24)16(3)28-22-11-15(2)27-21-5-4-18(13-20(21)22)29-8-6-26-7-9-29/h4-5,10-13,16,26H,6-9,25H2,1-3H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | LAQOOGIIAYDSBP-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|