C18H20Cl2FN3 — CID 86689051
N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-fluoro-5-piperazin-1-ylaniline (PubChem CID 86689051) has the molecular formula C18H20Cl2FN3 and a molecular weight of 368.28 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-fluoro-5-piperazin-1-ylaniline.
| Compound Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-fluoro-5-piperazin-1-ylaniline |
|---|---|
| PubChem CID | 86689051 |
| Molecular Formula | C18H20Cl2FN3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-2-fluoro-5-piperazin-1-ylaniline |
| SMILES | C[C@@H](Nc1cc(N2CCNCC2)ccc1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2FN3/c1-12(15-4-2-13(19)10-16(15)20)23-18-11-14(3-5-17(18)21)24-8-6-22-7-9-24/h2-5,10-12,22-23H,6-9H2,1H3/t12-/m1/s1 |
| InChIKey | MLKVQOSVLJTAIU-GFCCVEGCSA-N |
| XLogP | 4.72 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |