C25H32Cl2N4O — CID 126579503
2-[[4-[3-[1-(2,4-dichlorophenyl)ethylamino]-4-methylphenyl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde (PubChem CID 126579503) has the molecular formula C25H32Cl2N4O and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-[[4-[3-[1-(2,4-dichlorophenyl)ethylamino]-4-methylphenyl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde.
| Compound Name | 2-[[4-[3-[1-(2,4-dichlorophenyl)ethylamino]-4-methylphenyl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 126579503 |
| Molecular Formula | C25H32Cl2N4O |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[[4-[3-[1-(2,4-dichlorophenyl)ethylamino]-4-methylphenyl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde |
| SMILES | Cc1ccc(N2CCN(CC3(C=O)CCCN3)CC2)cc1NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H32Cl2N4O/c1-18-4-6-21(15-24(18)29-19(2)22-7-5-20(26)14-23(22)27)31-12-10-30(11-13-31)16-25(17-32)8-3-9-28-25/h4-7,14-15,17,19,28-29H,3,8-13,16H2,1-2H3 |
| InChIKey | VYMPXBBIDGHRIC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|