C19H20Cl2N4 — CID 86689055
2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-4-piperazin-1-ylbenzonitrile (PubChem CID 86689055) has the molecular formula C19H20Cl2N4 and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-4-piperazin-1-ylbenzonitrile.
| Compound Name | 2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-4-piperazin-1-ylbenzonitrile |
|---|---|
| PubChem CID | 86689055 |
| Molecular Formula | C19H20Cl2N4 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-4-piperazin-1-ylbenzonitrile |
| SMILES | C[C@@H](Nc1cc(N2CCNCC2)ccc1C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N4/c1-13(17-5-3-15(20)10-18(17)21)24-19-11-16(4-2-14(19)12-22)25-8-6-23-7-9-25/h2-5,10-11,13,23-24H,6-9H2,1H3/t13-/m1/s1 |
| InChIKey | HDEDBNNHXXZSIK-CYBMUJFWSA-N |
| XLogP | 4.45 |
| TPSA | 51.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |