C19H21Cl3N2 — CID 141364021
2-chloro-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-piperidin-1-ylaniline (PubChem CID 141364021) has the molecular formula C19H21Cl3N2 and a molecular weight of 383.75 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-piperidin-1-ylaniline.
| Compound Name | 2-chloro-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 141364021 |
| Molecular Formula | C19H21Cl3N2 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(2,4-dichlorophenyl)ethyl]-5-piperidin-1-ylaniline |
| SMILES | C[C@@H](Nc1cc(N2CCCCC2)ccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H21Cl3N2/c1-13(16-7-5-14(20)11-18(16)22)23-19-12-15(6-8-17(19)21)24-9-3-2-4-10-24/h5-8,11-13,23H,2-4,9-10H2,1H3/t13-/m1/s1 |
| InChIKey | KFPYVFQOKMJWSE-CYBMUJFWSA-N |
| XLogP | 6.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |