C25H29Cl2N5O — CID 148937579
2-[[4-[1-[1-(2,4-dichlorophenyl)ethyl]indazol-6-yl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde (PubChem CID 148937579) has the molecular formula C25H29Cl2N5O and a molecular weight of 486.45 g/mol. Its IUPAC name is 2-[[4-[1-[1-(2,4-dichlorophenyl)ethyl]indazol-6-yl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde.
| Compound Name | 2-[[4-[1-[1-(2,4-dichlorophenyl)ethyl]indazol-6-yl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 148937579 |
| Molecular Formula | C25H29Cl2N5O |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-[[4-[1-[1-(2,4-dichlorophenyl)ethyl]indazol-6-yl]piperazin-1-yl]methyl]pyrrolidine-2-carbaldehyde |
| SMILES | CC(c1ccc(Cl)cc1Cl)n1ncc2ccc(N3CCN(CC4(C=O)CCCN4)CC3)cc21 |
| InChI | InChI=1S/C25H29Cl2N5O/c1-18(22-6-4-20(26)13-23(22)27)32-24-14-21(5-3-19(24)15-29-32)31-11-9-30(10-12-31)16-25(17-33)7-2-8-28-25/h3-6,13-15,17-18,28H,2,7-12,16H2,1H3 |
| InChIKey | PNGKZUCMESFGMT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|