C20H22Cl2N4O — CID 174731393
1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(3S)-3-methoxypiperazin-1-yl]indazole (PubChem CID 174731393) has the molecular formula C20H22Cl2N4O and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(3S)-3-methoxypiperazin-1-yl]indazole.
| Compound Name | 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(3S)-3-methoxypiperazin-1-yl]indazole |
|---|---|
| PubChem CID | 174731393 |
| Molecular Formula | C20H22Cl2N4O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(3S)-3-methoxypiperazin-1-yl]indazole |
| SMILES | CO[C@H]1CN(c2ccc3cnn([C@H](C)c4ccc(Cl)cc4Cl)c3c2)CCN1 |
| InChI | InChI=1S/C20H22Cl2N4O/c1-13(17-6-4-15(21)9-18(17)22)26-19-10-16(5-3-14(19)11-24-26)25-8-7-23-20(12-25)27-2/h3-6,9-11,13,20,23H,7-8,12H2,1-2H3/t13-,20+/m1/s1 |
| InChIKey | FPAQIWDPMFPPQI-XCLFUZPHSA-N |
| XLogP | 4.33 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |