C23H25ClF3N5O2 — CID 175500249
2-methyl-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-piperazin-1-ylquinolin-4-amine;hydrochloride (PubChem CID 175500249) has the molecular formula C23H25ClF3N5O2 and a molecular weight of 495.93 g/mol. Its IUPAC name is 2-methyl-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-piperazin-1-ylquinolin-4-amine;hydrochloride.
| Compound Name | 2-methyl-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-piperazin-1-ylquinolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 175500249 |
| Molecular Formula | C23H25ClF3N5O2 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-methyl-N-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-6-piperazin-1-ylquinolin-4-amine;hydrochloride |
| SMILES | Cc1cc(NC(C)c2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(N3CCNCC3)ccc2n1.Cl |
| InChI | InChI=1S/C23H24F3N5O2.ClH/c1-14-9-22(20-13-18(3-4-21(20)28-14)30-7-5-27-6-8-30)29-15(2)16-10-17(23(24,25)26)12-19(11-16)31(32)33;/h3-4,9-13,15,27H,5-8H2,1-2H3,(H,28,29);1H |
| InChIKey | LENNLJNLASQVLM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|